C21H36 — CID 142828640
ethane;3-ethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 142828640) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is ethane;3-ethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | ethane;3-ethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142828640 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | ethane;3-ethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC.CCC1CCC2C(=CCC3C4CCCC4CCC23)C1 |
| InChI | InChI=1S/C19H30.C2H6/c1-2-13-6-9-17-15(12-13)8-11-18-16-5-3-4-14(16)7-10-19(17)18;1-2/h8,13-14,16-19H,2-7,9-12H2,1H3;1-2H3 |
| InChIKey | ILHBEORHSMSGOA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|