C19H28O — CID 154088667
1-[(8R,9R,10S,13S,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 154088667) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-[(8R,9R,10S,13S,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8R,9R,10S,13S,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 154088667 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-[(8R,9R,10S,13S,14S)-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CCC4CCCC[C@@H]4[C@H]3CC[C@H]12 |
| InChI | InChI=1S/C19H28O/c1-12(20)14-8-9-19-16(14)10-11-17-15-5-3-2-4-13(15)6-7-18(17)19/h8,13,15-19H,2-7,9-11H2,1H3/t13?,15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | NQXRPQYCUJLAIM-QBYZOWDCSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |