C28H49N3O2 — CID 175868638
2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl N,N-bis(3-amino-3-methylbutyl)carbamate (PubChem CID 175868638) has the molecular formula C28H49N3O2 and a molecular weight of 459.72 g/mol. Its IUPAC name is 2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl N,N-bis(3-amino-3-methylbutyl)carbamate.
| Compound Name | 2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl N,N-bis(3-amino-3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 175868638 |
| Molecular Formula | C28H49N3O2 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.38 |
| IUPAC Name | 2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl N,N-bis(3-amino-3-methylbutyl)carbamate |
| SMILES | CC(C)(N)CCN(CCC(C)(C)N)C(=O)OC1CCC2C(=CCC3C4CCCC4CCC23)C1 |
| InChI | InChI=1S/C28H49N3O2/c1-27(2,29)14-16-31(17-15-28(3,4)30)26(32)33-21-10-13-23-20(18-21)9-12-24-22-7-5-6-19(22)8-11-25(23)24/h9,19,21-25H,5-8,10-18,29-30H2,1-4H3 |
| InChIKey | UPFLFIQGWDQGGH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|