C35H58O6 — CID 146249435
[4-[[17-(6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutyl] 2,2-bis(hydroxymethyl)butanoate (PubChem CID 146249435) has the molecular formula C35H58O6 and a molecular weight of 574.84 g/mol. Its IUPAC name is [4-[[17-(6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutyl] 2,2-bis(hydroxymethyl)butanoate.
| Compound Name | [4-[[17-(6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutyl] 2,2-bis(hydroxymethyl)butanoate |
|---|---|
| PubChem CID | 146249435 |
| Molecular Formula | C35H58O6 |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | [4-[[17-(6-methylheptan-2-yl)-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutyl] 2,2-bis(hydroxymethyl)butanoate |
| SMILES | CCC(CO)(CO)C(=O)OCCCC(=O)OC1CCC2C(=CCC3C2CCC2C(C(C)CCCC(C)C)CCC23)C1 |
| InChI | InChI=1S/C35H58O6/c1-5-35(21-36,22-37)34(39)40-19-7-10-33(38)41-26-12-14-28-25(20-26)11-13-31-30(28)18-17-29-27(15-16-32(29)31)24(4)9-6-8-23(2)3/h11,23-24,26-32,36-37H,5-10,12-22H2,1-4H3 |
| InChIKey | CKASGMDQXKKZMM-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|