C27H46 — CID 176951997
(3S,9S,14R,17R)-3-ethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 176951997) has the molecular formula C27H46 and a molecular weight of 370.67 g/mol. Its IUPAC name is (3S,9S,14R,17R)-3-ethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,9S,14R,17R)-3-ethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 176951997 |
| Molecular Formula | C27H46 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | (3S,9S,14R,17R)-3-ethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CCC2C(=CCC3[C@@H]2CCC2[C@H]3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C27H46/c1-5-20-9-11-23-21(17-20)10-12-26-25(23)16-15-24-22(13-14-27(24)26)19(4)8-6-7-18(2)3/h10,18-20,22-27H,5-9,11-17H2,1-4H3/t19-,20+,22-,23?,24?,25-,26?,27-/m1/s1 |
| InChIKey | XJESLSJIOHGPND-MREKGKCXSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|