C25H40N2O — CID 163249597
17-[(Z)-6-amino-5-(methyliminomethyl)hex-5-en-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 163249597) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is 17-[(Z)-6-amino-5-(methyliminomethyl)hex-5-en-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[(Z)-6-amino-5-(methyliminomethyl)hex-5-en-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163249597 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 17-[(Z)-6-amino-5-(methyliminomethyl)hex-5-en-2-yl]-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/N=C/C(=C\N)CCC(C)C1CCC2C1CCC1C3CCC(O)CC3=CCC12 |
| InChI | InChI=1S/C25H40N2O/c1-16(3-4-17(14-26)15-27-2)20-9-10-25-22(20)11-12-23-21-8-6-19(28)13-18(21)5-7-24(23)25/h5,14-16,19-25,28H,3-4,6-13,26H2,1-2H3/b17-14-,27-15+ |
| InChIKey | VPBHHOXQTGJESO-UPKRDJBOSA-N |
| XLogP | 5.11 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|