C29H49NS — CID 142408280
17-(7-amino-6-methylheptan-2-yl)-3-(2-methylprop-2-enyl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-thiol (PubChem CID 142408280) has the molecular formula C29H49NS and a molecular weight of 443.79 g/mol. Its IUPAC name is 17-(7-amino-6-methylheptan-2-yl)-3-(2-methylprop-2-enyl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-thiol.
| Compound Name | 17-(7-amino-6-methylheptan-2-yl)-3-(2-methylprop-2-enyl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-thiol |
|---|---|
| PubChem CID | 142408280 |
| Molecular Formula | C29H49NS |
| Molecular Weight | 443.79 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | 17-(7-amino-6-methylheptan-2-yl)-3-(2-methylprop-2-enyl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-thiol |
| SMILES | C=C(C)CC1CCC2C(=CCC3C2CCC2(S)C(C(C)CCCC(C)CN)CCC32)C1 |
| InChI | InChI=1S/C29H49NS/c1-19(2)16-22-8-10-24-23(17-22)9-11-26-25(24)14-15-29(31)27(12-13-28(26)29)21(4)7-5-6-20(3)18-30/h9,20-22,24-28,31H,1,5-8,10-18,30H2,2-4H3 |
| InChIKey | RQVFKYBYFVZOBZ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.79 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|