C36H60 — CID 164908503
10,13-dimethyl-17-(6-methylheptan-2-yl)-3-[(E)-5-methyl-2-methylidenehept-5-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 164908503) has the molecular formula C36H60 and a molecular weight of 492.88 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-[(E)-5-methyl-2-methylidenehept-5-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-[(E)-5-methyl-2-methylidenehept-5-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 164908503 |
| Molecular Formula | C36H60 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.47 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-3-[(E)-5-methyl-2-methylidenehept-5-enyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(CC/C(C)=C/C)CC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C36H60/c1-9-26(4)13-14-27(5)23-29-19-21-35(7)30(24-29)15-16-31-33-18-17-32(28(6)12-10-11-25(2)3)36(33,8)22-20-34(31)35/h9,15,25,28-29,31-34H,5,10-14,16-24H2,1-4,6-8H3/b26-9+ |
| InChIKey | UBIQHINLOFDCBF-JQAMDZJQSA-N |
| XLogP | 11.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|