C26H29F2NS — CID 170936781
5-[2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene (PubChem CID 170936781) has the molecular formula C26H29F2NS and a molecular weight of 425.59 g/mol. Its IUPAC name is 5-[2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene.
| Compound Name | 5-[2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene |
|---|---|
| PubChem CID | 170936781 |
| Molecular Formula | C26H29F2NS |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 5-[2-[4-[4-(cyclobutylmethyl)cyclohexyl]cyclohexen-1-yl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene |
| SMILES | Fc1cc(C#CC2=CCC(C3CCC(CC4CCC4)CC3)CC2)cc(F)c1N=C=S |
| InChI | InChI=1S/C26H29F2NS/c27-24-15-21(16-25(28)26(24)29-17-30)5-4-18-6-10-22(11-7-18)23-12-8-20(9-13-23)14-19-2-1-3-19/h6,15-16,19-20,22-23H,1-3,7-14H2 |
| InChIKey | BHOQSPHFUTYGGI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|