C28H33F2NS — CID 174197775
[4-[2-[4-[4-(cyclopentylmethyl)cyclohexyl]-2-methylcyclohexen-1-yl]ethynyl]-2,6-difluorophenyl] thiocyanate (PubChem CID 174197775) has the molecular formula C28H33F2NS and a molecular weight of 453.64 g/mol. Its IUPAC name is [4-[2-[4-[4-(cyclopentylmethyl)cyclohexyl]-2-methylcyclohexen-1-yl]ethynyl]-2,6-difluorophenyl] thiocyanate.
| Compound Name | [4-[2-[4-[4-(cyclopentylmethyl)cyclohexyl]-2-methylcyclohexen-1-yl]ethynyl]-2,6-difluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 174197775 |
| Molecular Formula | C28H33F2NS |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [4-[2-[4-[4-(cyclopentylmethyl)cyclohexyl]-2-methylcyclohexen-1-yl]ethynyl]-2,6-difluorophenyl] thiocyanate |
| SMILES | CC1=C(C#Cc2cc(F)c(SC#N)c(F)c2)CCC(C2CCC(CC3CCCC3)CC2)C1 |
| InChI | InChI=1S/C28H33F2NS/c1-19-14-25(24-10-6-21(7-11-24)15-20-4-2-3-5-20)13-12-23(19)9-8-22-16-26(29)28(32-18-31)27(30)17-22/h16-17,20-21,24-25H,2-7,10-15H2,1H3 |
| InChIKey | KHSRXZBVHDYHEH-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|