C24H27F2NS — CID 170936795
1,3-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethynyl]benzene (PubChem CID 170936795) has the molecular formula C24H27F2NS and a molecular weight of 399.55 g/mol. Its IUPAC name is 1,3-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethynyl]benzene.
| Compound Name | 1,3-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethynyl]benzene |
|---|---|
| PubChem CID | 170936795 |
| Molecular Formula | C24H27F2NS |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1,3-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethynyl]benzene |
| SMILES | CCCC1CCC(C2CC=C(C#Cc3cc(F)c(N=C=S)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H27F2NS/c1-2-3-17-6-10-20(11-7-17)21-12-8-18(9-13-21)4-5-19-14-22(25)24(27-16-28)23(26)15-19/h8,14-15,17,20-21H,2-3,6-7,9-13H2,1H3 |
| InChIKey | VGAKDTZPFQVVHF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|