C19H34O — CID 139714691
4-butoxy-1-(4-propylcyclohexyl)cyclohexene (PubChem CID 139714691) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 4-butoxy-1-(4-propylcyclohexyl)cyclohexene.
| Compound Name | 4-butoxy-1-(4-propylcyclohexyl)cyclohexene |
|---|---|
| PubChem CID | 139714691 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 4-butoxy-1-(4-propylcyclohexyl)cyclohexene |
| SMILES | CCCCOC1CC=C(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C19H34O/c1-3-5-15-20-19-13-11-18(12-14-19)17-9-7-16(6-4-2)8-10-17/h11,16-17,19H,3-10,12-15H2,1-2H3 |
| InChIKey | YLUJDLMVMZQJCN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|