C33H43F3O2 — CID 89430015
1-[2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethyl]-2,3-difluoro-4-(4-propoxycyclohexen-1-yl)benzene (PubChem CID 89430015) has the molecular formula C33H43F3O2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 1-[2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethyl]-2,3-difluoro-4-(4-propoxycyclohexen-1-yl)benzene.
| Compound Name | 1-[2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethyl]-2,3-difluoro-4-(4-propoxycyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 89430015 |
| Molecular Formula | C33H43F3O2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 1-[2-[4-(4-butoxy-2-fluorophenyl)cyclohexyl]ethyl]-2,3-difluoro-4-(4-propoxycyclohexen-1-yl)benzene |
| SMILES | CCCCOc1ccc(C2CCC(CCc3ccc(C4=CCC(OCCC)CC4)c(F)c3F)CC2)c(F)c1 |
| InChI | InChI=1S/C33H43F3O2/c1-3-5-21-38-28-17-19-29(31(34)22-28)24-9-6-23(7-10-24)8-11-26-14-18-30(33(36)32(26)35)25-12-15-27(16-13-25)37-20-4-2/h12,14,17-19,22-24,27H,3-11,13,15-16,20-21H2,1-2H3 |
| InChIKey | SKRXJULOEDYOBJ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|