C32H34F4O2 — CID 89430290
1-(4-butoxycyclohexen-1-yl)-4-[2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]ethyl]-2,3-difluorobenzene (PubChem CID 89430290) has the molecular formula C32H34F4O2 and a molecular weight of 526.61 g/mol. Its IUPAC name is 1-(4-butoxycyclohexen-1-yl)-4-[2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]ethyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butoxycyclohexen-1-yl)-4-[2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]ethyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 89430290 |
| Molecular Formula | C32H34F4O2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 1-(4-butoxycyclohexen-1-yl)-4-[2-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]ethyl]-2,3-difluorobenzene |
| SMILES | CCCCOC1CC=C(c2ccc(CCc3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C32H34F4O2/c1-3-5-20-38-25-15-12-23(13-16-25)26-17-14-24(29(33)30(26)34)11-8-21-6-9-22(10-7-21)27-18-19-28(37-4-2)32(36)31(27)35/h6-7,9-10,12,14,17-19,25H,3-5,8,11,13,15-16,20H2,1-2H3 |
| InChIKey | QVRUZXCQJCNNSP-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|