C31H35F3O — CID 89124759
2-[4-[4-[2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]ethyl]cyclohexyl]-3-fluorophenyl]oxirane (PubChem CID 89124759) has the molecular formula C31H35F3O and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[4-[4-[2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]ethyl]cyclohexyl]-3-fluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]ethyl]cyclohexyl]-3-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 89124759 |
| Molecular Formula | C31H35F3O |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[4-[4-[2-[2,3-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]ethyl]cyclohexyl]-3-fluorophenyl]oxirane |
| SMILES | C/C=C/C1CC=C(c2ccc(CCC3CCC(c4ccc(C5CO5)cc4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H35F3O/c1-2-3-20-4-11-23(12-5-20)27-17-14-24(30(33)31(27)34)13-8-21-6-9-22(10-7-21)26-16-15-25(18-28(26)32)29-19-35-29/h2-3,11,14-18,20-22,29H,4-10,12-13,19H2,1H3/b3-2+ |
| InChIKey | NLFIHYYJJZBPPE-NSCUHMNNSA-N |
| XLogP | 8.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|