C19H21F5O — CID 76631728
2,3-difluoro-1-(4-prop-1-enylcyclohexen-1-yl)-4-(3,3,3-trifluoropropoxymethyl)benzene (PubChem CID 76631728) has the molecular formula C19H21F5O and a molecular weight of 360.37 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-prop-1-enylcyclohexen-1-yl)-4-(3,3,3-trifluoropropoxymethyl)benzene.
| Compound Name | 2,3-difluoro-1-(4-prop-1-enylcyclohexen-1-yl)-4-(3,3,3-trifluoropropoxymethyl)benzene |
|---|---|
| PubChem CID | 76631728 |
| Molecular Formula | C19H21F5O |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2,3-difluoro-1-(4-prop-1-enylcyclohexen-1-yl)-4-(3,3,3-trifluoropropoxymethyl)benzene |
| SMILES | CC=CC1CC=C(c2ccc(COCCC(F)(F)F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H21F5O/c1-2-3-13-4-6-14(7-5-13)16-9-8-15(17(20)18(16)21)12-25-11-10-19(22,23)24/h2-3,6,8-9,13H,4-5,7,10-12H2,1H3 |
| InChIKey | GLOGDLUHJGHHTN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|