C23H32O2 — CID 19986650
methyl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate (PubChem CID 19986650) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is methyl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate.
| Compound Name | methyl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 19986650 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | methyl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate |
| SMILES | CCCC1CCC(c2ccc(C3CC=C(C(=O)OC)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H32O2/c1-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(24)25-2/h9-12,15,17-18,21H,3-8,13-14,16H2,1-2H3 |
| InChIKey | CVOVWDUVSLECGF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |