C25H36O2 — CID 19986835
propan-2-yl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate (PubChem CID 19986835) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is propan-2-yl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate.
| Compound Name | propan-2-yl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 19986835 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | propan-2-yl 4-[4-(4-propylcyclohexyl)phenyl]cyclohexene-1-carboxylate |
| SMILES | CCCC1CCC(c2ccc(C3CC=C(C(=O)OC(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H36O2/c1-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-24(17-15-23)25(26)27-18(2)3/h10-13,16,18-20,23H,4-9,14-15,17H2,1-3H3 |
| InChIKey | DFFJYBDAZUMQPN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |