C10H18O — CID 163783069
[(4R)-4-propylcyclohexen-1-yl]methanol (PubChem CID 163783069) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is [(4R)-4-propylcyclohexen-1-yl]methanol.
| Compound Name | [(4R)-4-propylcyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 163783069 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | [(4R)-4-propylcyclohexen-1-yl]methanol |
| SMILES | CCC[C@H]1CC=C(CO)CC1 |
| InChI | InChI=1S/C10H18O/c1-2-3-9-4-6-10(8-11)7-5-9/h6,9,11H,2-5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | MQGJHTKMUMGCKN-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|