C15H26O2 — CID 162745512
2-[2-(4-butylcyclohexen-1-yl)ethyl]-1,3-dioxolane (PubChem CID 162745512) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[2-(4-butylcyclohexen-1-yl)ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(4-butylcyclohexen-1-yl)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 162745512 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[2-(4-butylcyclohexen-1-yl)ethyl]-1,3-dioxolane |
| SMILES | CCCCC1CC=C(CCC2OCCO2)CC1 |
| InChI | InChI=1S/C15H26O2/c1-2-3-4-13-5-7-14(8-6-13)9-10-15-16-11-12-17-15/h7,13,15H,2-6,8-12H2,1H3 |
| InChIKey | RLCVEAAHCBCYSH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|