C28H26F2O2 — CID 139854576
(5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]benzoate (PubChem CID 139854576) has the molecular formula C28H26F2O2 and a molecular weight of 432.51 g/mol. Its IUPAC name is (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]benzoate.
| Compound Name | (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 139854576 |
| Molecular Formula | C28H26F2O2 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (5-fluoronaphthalen-2-yl) 2-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]benzoate |
| SMILES | CCCC1CCC(C#Cc2ccc(C(=O)Oc3ccc4c(F)cccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H26F2O2/c1-2-4-19-7-9-20(10-8-19)11-12-21-13-15-25(27(30)17-21)28(31)32-23-14-16-24-22(18-23)5-3-6-26(24)29/h3,5-6,13-20H,2,4,7-10H2,1H3 |
| InChIKey | AZUZPRKFGANNQS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|