C25H25F5O — CID 139856066
1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856066) has the molecular formula C25H25F5O and a molecular weight of 436.46 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856066 |
| Molecular Formula | C25H25F5O |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethynyl]-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | C/C=C/CCC1CCC(C#Cc2cccc3c(F)c(OCC(F)(F)F)c(F)cc23)CC1 |
| InChI | InChI=1S/C25H25F5O/c1-2-3-4-6-17-9-11-18(12-10-17)13-14-19-7-5-8-20-21(19)15-22(26)24(23(20)27)31-16-25(28,29)30/h2-3,5,7-8,15,17-18H,4,6,9-12,16H2,1H3/b3-2+ |
| InChIKey | WRORPWHWYXQWDU-NSCUHMNNSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|