C27H29FO2 — CID 59929154
[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate (PubChem CID 59929154) has the molecular formula C27H29FO2 and a molecular weight of 404.53 g/mol. Its IUPAC name is [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59929154 |
| Molecular Formula | C27H29FO2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-[(E)-pent-3-enyl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCC1CCC(C(=O)Oc2ccc(C#Cc3ccc(C)cc3F)cc2)CC1 |
| InChI | InChI=1S/C27H29FO2/c1-3-4-5-6-21-9-15-24(16-10-21)27(29)30-25-17-11-22(12-18-25)8-14-23-13-7-20(2)19-26(23)28/h3-4,7,11-13,17-19,21,24H,5-6,9-10,15-16H2,1-2H3/b4-3+ |
| InChIKey | JOLQIFWEONRFRP-ONEGZZNKSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|