C25H25FO3 — CID 59929109
[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-prop-2-enoxycyclohexane-1-carboxylate (PubChem CID 59929109) has the molecular formula C25H25FO3 and a molecular weight of 392.47 g/mol. Its IUPAC name is [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-prop-2-enoxycyclohexane-1-carboxylate.
| Compound Name | [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-prop-2-enoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59929109 |
| Molecular Formula | C25H25FO3 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl] 4-prop-2-enoxycyclohexane-1-carboxylate |
| SMILES | C=CCOC1CCC(C(=O)Oc2ccc(C#Cc3ccc(C)cc3F)cc2)CC1 |
| InChI | InChI=1S/C25H25FO3/c1-3-16-28-22-14-10-21(11-15-22)25(27)29-23-12-6-19(7-13-23)5-9-20-8-4-18(2)17-24(20)26/h3-4,6-8,12-13,17,21-22H,1,10-11,14-16H2,2H3 |
| InChIKey | PICXWFVEBMCPII-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|