C26H27F5O — CID 139708902
5-[2-(4-ethylcyclohexyl)propyl]-1,3-difluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene (PubChem CID 139708902) has the molecular formula C26H27F5O and a molecular weight of 450.49 g/mol. Its IUPAC name is 5-[2-(4-ethylcyclohexyl)propyl]-1,3-difluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene.
| Compound Name | 5-[2-(4-ethylcyclohexyl)propyl]-1,3-difluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 139708902 |
| Molecular Formula | C26H27F5O |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 5-[2-(4-ethylcyclohexyl)propyl]-1,3-difluoro-2-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
| SMILES | CCC1CCC(C(C)Cc2cc(F)c(C#Cc3ccc(OC(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H27F5O/c1-3-18-4-9-21(10-5-18)17(2)14-20-15-24(27)23(25(28)16-20)13-8-19-6-11-22(12-7-19)32-26(29,30)31/h6-7,11-12,15-18,21H,3-5,9-10,14H2,1-2H3 |
| InChIKey | LFNDHSJAHMOTDX-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|