C23H25ClF4 — CID 139708610
2-chloro-5-[4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorophenyl]-1,3-difluorobenzene (PubChem CID 139708610) has the molecular formula C23H25ClF4 and a molecular weight of 412.90 g/mol. Its IUPAC name is 2-chloro-5-[4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorophenyl]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139708610 |
| Molecular Formula | C23H25ClF4 |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-chloro-5-[4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorophenyl]-1,3-difluorobenzene |
| SMILES | CCC1CCC(C(C)Cc2cc(F)c(-c3cc(F)c(Cl)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H25ClF4/c1-3-14-4-6-16(7-5-14)13(2)8-15-9-18(25)22(19(26)10-15)17-11-20(27)23(24)21(28)12-17/h9-14,16H,3-8H2,1-2H3 |
| InChIKey | OBOFNRRNJAFOSP-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|