C18H25F3 — CID 139691879
1,2,3-trifluoro-5-[2-(4-propylcyclohexyl)propyl]benzene (PubChem CID 139691879) has the molecular formula C18H25F3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-(4-propylcyclohexyl)propyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-(4-propylcyclohexyl)propyl]benzene |
|---|---|
| PubChem CID | 139691879 |
| Molecular Formula | C18H25F3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-(4-propylcyclohexyl)propyl]benzene |
| SMILES | CCCC1CCC(C(C)Cc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H25F3/c1-3-4-13-5-7-15(8-6-13)12(2)9-14-10-16(19)18(21)17(20)11-14/h10-13,15H,3-9H2,1-2H3 |
| InChIKey | HVGFGVOZEQZAGS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|