C18H27I — CID 139711194
1-iodo-4-[2-(4-propylcyclohexyl)propyl]benzene (PubChem CID 139711194) has the molecular formula C18H27I and a molecular weight of 370.32 g/mol. Its IUPAC name is 1-iodo-4-[2-(4-propylcyclohexyl)propyl]benzene.
| Compound Name | 1-iodo-4-[2-(4-propylcyclohexyl)propyl]benzene |
|---|---|
| PubChem CID | 139711194 |
| Molecular Formula | C18H27I |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-iodo-4-[2-(4-propylcyclohexyl)propyl]benzene |
| SMILES | CCCC1CCC(C(C)Cc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C18H27I/c1-3-4-15-5-9-17(10-6-15)14(2)13-16-7-11-18(19)12-8-16/h7-8,11-12,14-15,17H,3-6,9-10,13H2,1-2H3 |
| InChIKey | DIOBTSTYJQLXIB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|