C20H27N — CID 58840173
4-(5,5,7,7-tetradeuterio-6-propyl-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl)benzonitrile (PubChem CID 58840173) has the molecular formula C20H27N and a molecular weight of 285.47 g/mol. Its IUPAC name is 4-(5,5,7,7-tetradeuterio-6-propyl-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl)benzonitrile.
| Compound Name | 4-(5,5,7,7-tetradeuterio-6-propyl-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl)benzonitrile |
|---|---|
| PubChem CID | 58840173 |
| Molecular Formula | C20H27N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 4-(5,5,7,7-tetradeuterio-6-propyl-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl)benzonitrile |
| SMILES | [2H]C1([2H])CC2CC(c3ccc(C#N)cc3)CCC2C([2H])([2H])C1CCC |
| InChI | InChI=1S/C20H27N/c1-2-3-15-4-9-20-13-19(11-10-18(20)12-15)17-7-5-16(14-21)6-8-17/h5-8,15,18-20H,2-4,9-13H2,1H3/i4D2,12D2 |
| InChIKey | OXHZKCONKCMTAJ-QWUSTQTASA-N |
| XLogP | 5.66 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |