About 1-decyl-4-iodobenzene tetrafluoroborate
1-decyl-4-iodobenzene tetrafluoroborate (PubChem CID 174595981) has the molecular formula C16H25BF4I-
and a molecular weight of 431.08 g/mol. Its IUPAC name is 1-decyl-4-iodobenzene tetrafluoroborate.
Molecular Properties
| Compound Name | 1-decyl-4-iodobenzene tetrafluoroborate |
| PubChem CID | 174595981 |
| Molecular Formula | C16H25BF4I- |
| Molecular Weight | 431.08 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-decyl-4-iodobenzene tetrafluoroborate |
| SMILES | CCCCCCCCCCc1ccc(I)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C16H25I.BF4/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15;2-1(3,4)5/h11-14H,2-10H2,1H3;/q;-1 |
| InChIKey | ZZAPEOJIFZRHDX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.08 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-4-iodobenzene tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-4-iodobenzene tetrafluoroborate?
The IUPAC name of 1-decyl-4-iodobenzene tetrafluoroborate (CID 174595981) is 1-decyl-4-iodobenzene tetrafluoroborate.
What is the SMILES notation for 1-decyl-4-iodobenzene tetrafluoroborate?
The canonical SMILES for 1-decyl-4-iodobenzene tetrafluoroborate is CCCCCCCCCCc1ccc(I)cc1.F[B-](F)(F)F.
What is the InChIKey of 1-decyl-4-iodobenzene tetrafluoroborate?
The InChIKey is ZZAPEOJIFZRHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25I.BF4/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15;2-1(3,4)5/h11-14H,2-10H2,1H3;/q;-1.
What are the key properties of 1-decyl-4-iodobenzene tetrafluoroborate?
1-decyl-4-iodobenzene tetrafluoroborate has a molecular weight of 431.08 g/mol, XLogP of 7.27, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-4-iodobenzene tetrafluoroborate is sourced from PubChem (CID 174595981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).