C40H52F9O3PS — CID 158175205
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hexylphenyl)phosphanium (PubChem CID 158175205) has the molecular formula C40H52F9O3PS and a molecular weight of 814.88 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hexylphenyl)phosphanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hexylphenyl)phosphanium |
|---|---|
| PubChem CID | 158175205 |
| Molecular Formula | C40H52F9O3PS |
| Molecular Weight | 814.88 g/mol |
| Exact Mass | 814.32 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hexylphenyl)phosphanium |
| SMILES | CCCCCCc1ccc([PH+](c2ccc(CCCCCC)cc2)c2ccc(CCCCCC)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H51P.C4HF9O3S/c1-4-7-10-13-16-31-19-25-34(26-20-31)37(35-27-21-32(22-28-35)17-14-11-8-5-2)36-29-23-33(24-30-36)18-15-12-9-6-3;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h19-30H,4-18H2,1-3H3;(H,14,15,16) |
| InChIKey | FXXODCALXVTRLK-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.88 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|