C6H6F6N2O6S2 — CID 139235356
pyrazine-1,4-diium;bis(trifluoromethanesulfonate) (PubChem CID 139235356) has the molecular formula C6H6F6N2O6S2 and a molecular weight of 380.24 g/mol. Its IUPAC name is pyrazine-1,4-diium;bis(trifluoromethanesulfonate).
| Compound Name | pyrazine-1,4-diium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139235356 |
| Molecular Formula | C6H6F6N2O6S2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | pyrazine-1,4-diium;bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1c[nH+]cc[nH+]1 |
| InChI | InChI=1S/C4H4N2.2CHF3O3S/c1-2-6-4-3-5-1;2*2-1(3,4)8(5,6)7/h1-4H;2*(H,5,6,7) |
| InChIKey | OSNKRXFOWMAECZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 142.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|