C4H4F3NO4S — CID 19748307
1,3-oxazol-3-ium;trifluoromethanesulfonate (PubChem CID 19748307) has the molecular formula C4H4F3NO4S and a molecular weight of 219.14 g/mol. Its IUPAC name is 1,3-oxazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 1,3-oxazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19748307 |
| Molecular Formula | C4H4F3NO4S |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | 1,3-oxazol-3-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1coc[nH+]1 |
| InChI | InChI=1S/C3H3NO.CHF3O3S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7) |
| InChIKey | VTGSQWNSNWNILC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|