About 1,3-oxazol-3-ium;trifluoromethanesulfonate
1,3-oxazol-3-ium;trifluoromethanesulfonate (PubChem CID 19748307) has the molecular formula C4H4F3NO4S
and a molecular weight of 219.14 g/mol. Its IUPAC name is 1,3-oxazol-3-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1,3-oxazol-3-ium;trifluoromethanesulfonate |
| PubChem CID | 19748307 |
| Molecular Formula | C4H4F3NO4S |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | 1,3-oxazol-3-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1coc[nH+]1 |
| InChI | InChI=1S/C3H3NO.CHF3O3S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7) |
| InChIKey | VTGSQWNSNWNILC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxazol-3-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazol-3-ium;trifluoromethanesulfonate?
The IUPAC name of 1,3-oxazol-3-ium;trifluoromethanesulfonate (CID 19748307) is 1,3-oxazol-3-ium;trifluoromethanesulfonate.
What is the SMILES notation for 1,3-oxazol-3-ium;trifluoromethanesulfonate?
The canonical SMILES for 1,3-oxazol-3-ium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.c1coc[nH+]1.
What is the InChIKey of 1,3-oxazol-3-ium;trifluoromethanesulfonate?
The InChIKey is VTGSQWNSNWNILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO.CHF3O3S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7/h1-3H;(H,5,6,7).
What are the key properties of 1,3-oxazol-3-ium;trifluoromethanesulfonate?
1,3-oxazol-3-ium;trifluoromethanesulfonate has a molecular weight of 219.14 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazol-3-ium;trifluoromethanesulfonate is sourced from PubChem (CID 19748307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).