C5H6F3NO4S — CID 141418678
2-methyl-1,3-oxazol-3-ium;trifluoromethanesulfonate (PubChem CID 141418678) has the molecular formula C5H6F3NO4S and a molecular weight of 233.17 g/mol. Its IUPAC name is 2-methyl-1,3-oxazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 2-methyl-1,3-oxazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141418678 |
| Molecular Formula | C5H6F3NO4S |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 2-methyl-1,3-oxazol-3-ium;trifluoromethanesulfonate |
| SMILES | Cc1[nH+]cco1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C4H5NO.CHF3O3S/c1-4-5-2-3-6-4;2-1(3,4)8(5,6)7/h2-3H,1H3;(H,5,6,7) |
| InChIKey | GYBZCJQYRNGWAA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|