About methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine
methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine (PubChem CID 135411162) has the molecular formula C7H10N2O4S
and a molecular weight of 220.23 g/mol. Its IUPAC name is methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine.
Molecular Properties
| Compound Name | methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine |
| PubChem CID | 135411162 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine |
| SMILES | CS(=O)(=O)[O-].O/N=[14CH]/c1cccc[nH+]1 |
| InChI | InChI=1S/C6H6N2O.CH4O3S/c9-8-5-6-3-1-2-4-7-6;1-5(2,3)4/h1-5,9H;1H3,(H,2,3,4)/b8-5+;/i5+2; |
| InChIKey | GWEWGZDHMWYXLQ-LXMNLMDRSA-N |
| XLogP | -0.53 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine?
The IUPAC name of methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine (CID 135411162) is methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine.
What is the SMILES notation for methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine?
The canonical SMILES for methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine is CS(=O)(=O)[O-].O/N=[14CH]/c1cccc[nH+]1.
What is the InChIKey of methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine?
The InChIKey is GWEWGZDHMWYXLQ-LXMNLMDRSA-N. The full InChI is InChI=1S/C6H6N2O.CH4O3S/c9-8-5-6-3-1-2-4-7-6;1-5(2,3)4/h1-5,9H;1H3,(H,2,3,4)/b8-5+;/i5+2;.
What are the key properties of methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine?
methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine has a molecular weight of 220.23 g/mol, XLogP of -0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;(NE)-N-(pyridin-1-ium-2-yl(114C)methylidene)hydroxylamine is sourced from PubChem (CID 135411162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).