C11H10N2O4 — CID 139048844
1H-benzimidazol-3-ium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 139048844) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 1H-benzimidazol-3-ium;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 139048844 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1H-benzimidazol-3-ium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C\C(=O)O.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C4H4O4/c1-2-4-7-6(3-1)8-5-9-7;5-3(6)1-2-4(7)8/h1-5H,(H,8,9);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XWJQEVCIGCQTNQ-BTJKTKAUSA-N |
| XLogP | -0.64 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|