About (E)-but-2-enedioate;bis(diphenylphosphanium)
(E)-but-2-enedioate;bis(diphenylphosphanium) (PubChem CID 160830122) has the molecular formula C28H26O4P2
and a molecular weight of 488.46 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis(diphenylphosphanium).
Molecular Properties
| Compound Name | (E)-but-2-enedioate;bis(diphenylphosphanium) |
| PubChem CID | 160830122 |
| Molecular Formula | C28H26O4P2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (E)-but-2-enedioate;bis(diphenylphosphanium) |
| SMILES | O=C([O-])/C=C/C(=O)[O-].c1ccc([PH2+]c2ccccc2)cc1.c1ccc([PH2+]c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H11P.C4H4O4/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-3(6)1-2-4(7)8/h2*1-10,13H;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | ASSKGMBGXDSYOY-WXXKFALUSA-N |
| XLogP | 1.14 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate;bis(diphenylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate;bis(diphenylphosphanium)?
The IUPAC name of (E)-but-2-enedioate;bis(diphenylphosphanium) (CID 160830122) is (E)-but-2-enedioate;bis(diphenylphosphanium).
What is the SMILES notation for (E)-but-2-enedioate;bis(diphenylphosphanium)?
The canonical SMILES for (E)-but-2-enedioate;bis(diphenylphosphanium) is O=C([O-])/C=C/C(=O)[O-].c1ccc([PH2+]c2ccccc2)cc1.c1ccc([PH2+]c2ccccc2)cc1.
What is the InChIKey of (E)-but-2-enedioate;bis(diphenylphosphanium)?
The InChIKey is ASSKGMBGXDSYOY-WXXKFALUSA-N. The full InChI is InChI=1S/2C12H11P.C4H4O4/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-3(6)1-2-4(7)8/h2*1-10,13H;1-2H,(H,5,6)(H,7,8)/b;;2-1+.
What are the key properties of (E)-but-2-enedioate;bis(diphenylphosphanium)?
(E)-but-2-enedioate;bis(diphenylphosphanium) has a molecular weight of 488.46 g/mol, XLogP of 1.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate;bis(diphenylphosphanium) is sourced from PubChem (CID 160830122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).