About bis(phenazin-5-ium);sulfate
bis(phenazin-5-ium);sulfate (PubChem CID 19010277) has the molecular formula C24H18N4O4S
and a molecular weight of 458.50 g/mol. Its IUPAC name is bis(phenazin-5-ium);sulfate.
Molecular Properties
| Compound Name | bis(phenazin-5-ium);sulfate |
| PubChem CID | 19010277 |
| Molecular Formula | C24H18N4O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | bis(phenazin-5-ium);sulfate |
| SMILES | O=S(=O)([O-])[O-].c1ccc2[nH+]c3ccccc3nc2c1.c1ccc2[nH+]c3ccccc3nc2c1 |
| InChI | InChI=1S/2C12H8N2.H2O4S/c2*1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-5(2,3)4/h2*1-8H;(H2,1,2,3,4) |
| InChIKey | BMZBMEHYRPWQHI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(phenazin-5-ium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(phenazin-5-ium);sulfate?
The IUPAC name of bis(phenazin-5-ium);sulfate (CID 19010277) is bis(phenazin-5-ium);sulfate.
What is the SMILES notation for bis(phenazin-5-ium);sulfate?
The canonical SMILES for bis(phenazin-5-ium);sulfate is O=S(=O)([O-])[O-].c1ccc2[nH+]c3ccccc3nc2c1.c1ccc2[nH+]c3ccccc3nc2c1.
What is the InChIKey of bis(phenazin-5-ium);sulfate?
The InChIKey is BMZBMEHYRPWQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8N2.H2O4S/c2*1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-5(2,3)4/h2*1-8H;(H2,1,2,3,4).
What are the key properties of bis(phenazin-5-ium);sulfate?
bis(phenazin-5-ium);sulfate has a molecular weight of 458.50 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(phenazin-5-ium);sulfate is sourced from PubChem (CID 19010277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).