About dimethyl(phenyl)sulfanium;hydron;sulfate
dimethyl(phenyl)sulfanium;hydron;sulfate (PubChem CID 23149376) has the molecular formula C8H12O4S2
and a molecular weight of 236.31 g/mol. Its IUPAC name is dimethyl(phenyl)sulfanium;hydron;sulfate.
Molecular Properties
| Compound Name | dimethyl(phenyl)sulfanium;hydron;sulfate |
| PubChem CID | 23149376 |
| Molecular Formula | C8H12O4S2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | dimethyl(phenyl)sulfanium;hydron;sulfate |
| SMILES | C[S+](C)c1ccccc1.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C8H11S.H2O4S/c1-9(2)8-6-4-3-5-7-8;1-5(2,3)4/h3-7H,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | PPULPJBHJWZWAG-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)sulfanium;hydron;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)sulfanium;hydron;sulfate?
The IUPAC name of dimethyl(phenyl)sulfanium;hydron;sulfate (CID 23149376) is dimethyl(phenyl)sulfanium;hydron;sulfate.
What is the SMILES notation for dimethyl(phenyl)sulfanium;hydron;sulfate?
The canonical SMILES for dimethyl(phenyl)sulfanium;hydron;sulfate is C[S+](C)c1ccccc1.O=S(=O)([O-])[O-].[H+].
What is the InChIKey of dimethyl(phenyl)sulfanium;hydron;sulfate?
The InChIKey is PPULPJBHJWZWAG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11S.H2O4S/c1-9(2)8-6-4-3-5-7-8;1-5(2,3)4/h3-7H,1-2H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of dimethyl(phenyl)sulfanium;hydron;sulfate?
dimethyl(phenyl)sulfanium;hydron;sulfate has a molecular weight of 236.31 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)sulfanium;hydron;sulfate is sourced from PubChem (CID 23149376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).