C11H14F3NO — CID 118144058
2-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 118144058) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol.
| Compound Name | 2-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 118144058 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(4-aminophenyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | CCCC(O)(c1ccc(N)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO/c1-2-7-10(16,11(12,13)14)8-3-5-9(15)6-4-8/h3-6,16H,2,7,15H2,1H3 |
| InChIKey | WSCZKVVDMVPFBT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|