C15H10BrF4O3- — CID 22044228
2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane (PubChem CID 22044228) has the molecular formula C15H10BrF4O3- and a molecular weight of 394.14 g/mol. Its IUPAC name is 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane.
| Compound Name | 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane |
|---|---|
| PubChem CID | 22044228 |
| Molecular Formula | C15H10BrF4O3- |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane |
| SMILES | CBr.O=C([O-])C(O)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F4O3.CH3Br/c15-9-3-1-7(5-11(9)17)14(21,13(19)20)8-2-4-10(16)12(18)6-8;1-2/h1-6,21H,(H,19,20);1H3/p-1 |
| InChIKey | NMBSBQQFQKDQKO-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|