About 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane
2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane (PubChem CID 22044228) has the molecular formula C15H10BrF4O3-
and a molecular weight of 394.14 g/mol. Its IUPAC name is 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane.
Molecular Properties
| Compound Name | 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane |
| PubChem CID | 22044228 |
| Molecular Formula | C15H10BrF4O3- |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane |
| SMILES | CBr.O=C([O-])C(O)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F4O3.CH3Br/c15-9-3-1-7(5-11(9)17)14(21,13(19)20)8-2-4-10(16)12(18)6-8;1-2/h1-6,21H,(H,19,20);1H3/p-1 |
| InChIKey | NMBSBQQFQKDQKO-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane?
The IUPAC name of 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane (CID 22044228) is 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane.
What is the SMILES notation for 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane?
The canonical SMILES for 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane is CBr.O=C([O-])C(O)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1.
What is the InChIKey of 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane?
The InChIKey is NMBSBQQFQKDQKO-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8F4O3.CH3Br/c15-9-3-1-7(5-11(9)17)14(21,13(19)20)8-2-4-10(16)12(18)6-8;1-2/h1-6,21H,(H,19,20);1H3/p-1.
What are the key properties of 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane?
2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane has a molecular weight of 394.14 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(3,4-difluorophenyl)-2-hydroxyacetate;bromomethane is sourced from PubChem (CID 22044228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).