C11H12F2O — CID 62802186
1-cyclopropyl-1-(3,4-difluorophenyl)ethanol (PubChem CID 62802186) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 1-cyclopropyl-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-cyclopropyl-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 62802186 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-cyclopropyl-1-(3,4-difluorophenyl)ethanol |
| SMILES | CC(O)(c1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C11H12F2O/c1-11(14,7-2-3-7)8-4-5-9(12)10(13)6-8/h4-7,14H,2-3H2,1H3 |
| InChIKey | CKRXNZNIXKQZCL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |