C12H14F2O3 — CID 94425144
ethyl (3S)-3-(3,4-difluorophenyl)-3-hydroxybutanoate (PubChem CID 94425144) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is ethyl (3S)-3-(3,4-difluorophenyl)-3-hydroxybutanoate.
| Compound Name | ethyl (3S)-3-(3,4-difluorophenyl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 94425144 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | ethyl (3S)-3-(3,4-difluorophenyl)-3-hydroxybutanoate |
| SMILES | CCOC(=O)C[C@](C)(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O3/c1-3-17-11(15)7-12(2,16)8-4-5-9(13)10(14)6-8/h4-6,16H,3,7H2,1-2H3/t12-/m0/s1 |
| InChIKey | RHOUCOAVEBIHJB-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |