C13H18F2O — CID 80557714
2-(3,4-difluorophenyl)heptan-2-ol (PubChem CID 80557714) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)heptan-2-ol.
| Compound Name | 2-(3,4-difluorophenyl)heptan-2-ol |
|---|---|
| PubChem CID | 80557714 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-(3,4-difluorophenyl)heptan-2-ol |
| SMILES | CCCCCC(C)(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2O/c1-3-4-5-8-13(2,16)10-6-7-11(14)12(15)9-10/h6-7,9,16H,3-5,8H2,1-2H3 |
| InChIKey | SPGUOXYMQADBBP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|