C17H28O3 — CID 80557836
2-(3,4-diethoxyphenyl)heptan-2-ol (PubChem CID 80557836) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)heptan-2-ol.
| Compound Name | 2-(3,4-diethoxyphenyl)heptan-2-ol |
|---|---|
| PubChem CID | 80557836 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)heptan-2-ol |
| SMILES | CCCCCC(C)(O)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C17H28O3/c1-5-8-9-12-17(4,18)14-10-11-15(19-6-2)16(13-14)20-7-3/h10-11,13,18H,5-9,12H2,1-4H3 |
| InChIKey | GSUFMYHBABGXMS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|