C9H8F2O3 — CID 61237250
2-(3,4-difluorophenyl)-2-hydroxypropanoic acid (PubChem CID 61237250) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-hydroxypropanoic acid.
| Compound Name | 2-(3,4-difluorophenyl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61237250 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-hydroxypropanoic acid |
| SMILES | CC(O)(C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H8F2O3/c1-9(14,8(12)13)5-2-3-6(10)7(11)4-5/h2-4,14H,1H3,(H,12,13) |
| InChIKey | BOGHUECNIVZWRH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |