C16H16F2N2O — CID 60996994
2-(4-fluoroanilino)-2-(4-fluorophenyl)butanamide (PubChem CID 60996994) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-2-(4-fluorophenyl)butanamide.
| Compound Name | 2-(4-fluoroanilino)-2-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 60996994 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-fluoroanilino)-2-(4-fluorophenyl)butanamide |
| SMILES | CCC(Nc1ccc(F)cc1)(C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F2N2O/c1-2-16(15(19)21,11-3-5-12(17)6-4-11)20-14-9-7-13(18)8-10-14/h3-10,20H,2H2,1H3,(H2,19,21) |
| InChIKey | WCJYAAYHUQRRBD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |