C14H17F4NO2 — CID 60997637
ethyl 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoate (PubChem CID 60997637) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoate.
| Compound Name | ethyl 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoate |
|---|---|
| PubChem CID | 60997637 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoate |
| SMILES | CCOC(=O)C(CC)(NCC(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17F4NO2/c1-3-13(12(20)21-4-2,19-9-14(16,17)18)10-5-7-11(15)8-6-10/h5-8,19H,3-4,9H2,1-2H3 |
| InChIKey | KNJFDCMOBIZXGN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |