C12H14F3NO2 — CID 60997859
2-phenyl-2-(2,2,2-trifluoroethylamino)butanoic acid (PubChem CID 60997859) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-phenyl-2-(2,2,2-trifluoroethylamino)butanoic acid.
| Compound Name | 2-phenyl-2-(2,2,2-trifluoroethylamino)butanoic acid |
|---|---|
| PubChem CID | 60997859 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-phenyl-2-(2,2,2-trifluoroethylamino)butanoic acid |
| SMILES | CCC(NCC(F)(F)F)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H14F3NO2/c1-2-11(10(17)18,16-8-12(13,14)15)9-6-4-3-5-7-9/h3-7,16H,2,8H2,1H3,(H,17,18) |
| InChIKey | NQPSRRBVEOYGJA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |