C12H13F4NO2 — CID 54892938
2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoic acid (PubChem CID 54892938) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoic acid.
| Compound Name | 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoic acid |
|---|---|
| PubChem CID | 54892938 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(4-fluorophenyl)-2-(2,2,2-trifluoroethylamino)butanoic acid |
| SMILES | CCC(NCC(F)(F)F)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13F4NO2/c1-2-11(10(18)19,17-7-12(14,15)16)8-3-5-9(13)6-4-8/h3-6,17H,2,7H2,1H3,(H,18,19) |
| InChIKey | WIUOIMSJJWUSFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |